C10H13N5 — CID 84671641
2-piperidin-4-yl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 84671641) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-piperidin-4-yl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-piperidin-4-yl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 84671641 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-piperidin-4-yl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | c1cnc2nc(C3CCNCC3)nn2c1 |
| InChI | InChI=1S/C10H13N5/c1-4-12-10-13-9(14-15(10)7-1)8-2-5-11-6-3-8/h1,4,7-8,11H,2-3,5-6H2 |
| InChIKey | CVZXKZGCACLUOP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |