C18H30N6O — CID 72897316
4-[4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-6-propan-2-yloxypyrimidin-2-amine (PubChem CID 72897316) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is 4-[4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-6-propan-2-yloxypyrimidin-2-amine.
| Compound Name | 4-[4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-6-propan-2-yloxypyrimidin-2-amine |
|---|---|
| PubChem CID | 72897316 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 4-[4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-6-propan-2-yloxypyrimidin-2-amine |
| SMILES | CC(C)Oc1cc(N2CCN(C3CN4CCC3CC4)CC2)nc(N)n1 |
| InChI | InChI=1S/C18H30N6O/c1-13(2)25-17-11-16(20-18(19)21-17)24-9-7-23(8-10-24)15-12-22-5-3-14(15)4-6-22/h11,13-15H,3-10,12H2,1-2H3,(H2,19,20,21) |
| InChIKey | UBRHOEFBRDZJHR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |