C13H23N5O3S — CID 50982057
N-[1-(2-amino-6-propan-2-yloxypyrimidin-4-yl)piperidin-4-yl]methanesulfonamide (PubChem CID 50982057) has the molecular formula C13H23N5O3S and a molecular weight of 329.43 g/mol. Its IUPAC name is N-[1-(2-amino-6-propan-2-yloxypyrimidin-4-yl)piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-(2-amino-6-propan-2-yloxypyrimidin-4-yl)piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 50982057 |
| Molecular Formula | C13H23N5O3S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-[1-(2-amino-6-propan-2-yloxypyrimidin-4-yl)piperidin-4-yl]methanesulfonamide |
| SMILES | CC(C)Oc1cc(N2CCC(NS(C)(=O)=O)CC2)nc(N)n1 |
| InChI | InChI=1S/C13H23N5O3S/c1-9(2)21-12-8-11(15-13(14)16-12)18-6-4-10(5-7-18)17-22(3,19)20/h8-10,17H,4-7H2,1-3H3,(H2,14,15,16) |
| InChIKey | IBFNMICXQLSTML-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |