C18H16N4O — CID 72897730
[4-(1H-pyrazol-5-yl)phenyl]-(3-pyridin-2-ylazetidin-1-yl)methanone (PubChem CID 72897730) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is [4-(1H-pyrazol-5-yl)phenyl]-(3-pyridin-2-ylazetidin-1-yl)methanone.
| Compound Name | [4-(1H-pyrazol-5-yl)phenyl]-(3-pyridin-2-ylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 72897730 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [4-(1H-pyrazol-5-yl)phenyl]-(3-pyridin-2-ylazetidin-1-yl)methanone |
| SMILES | O=C(c1ccc(-c2ccn[nH]2)cc1)N1CC(c2ccccn2)C1 |
| InChI | InChI=1S/C18H16N4O/c23-18(22-11-15(12-22)16-3-1-2-9-19-16)14-6-4-13(5-7-14)17-8-10-20-21-17/h1-10,15H,11-12H2,(H,20,21) |
| InChIKey | ZOZVSPGQUQSCAK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |