C19H24N4OS — CID 72905498
[4-(1H-pyrazol-5-yl)phenyl]-(4-thiomorpholin-4-ylpiperidin-1-yl)methanone (PubChem CID 72905498) has the molecular formula C19H24N4OS and a molecular weight of 356.49 g/mol. Its IUPAC name is [4-(1H-pyrazol-5-yl)phenyl]-(4-thiomorpholin-4-ylpiperidin-1-yl)methanone.
| Compound Name | [4-(1H-pyrazol-5-yl)phenyl]-(4-thiomorpholin-4-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 72905498 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [4-(1H-pyrazol-5-yl)phenyl]-(4-thiomorpholin-4-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(-c2ccn[nH]2)cc1)N1CCC(N2CCSCC2)CC1 |
| InChI | InChI=1S/C19H24N4OS/c24-19(16-3-1-15(2-4-16)18-5-8-20-21-18)23-9-6-17(7-10-23)22-11-13-25-14-12-22/h1-5,8,17H,6-7,9-14H2,(H,20,21) |
| InChIKey | LPGJVCVDHQKKOA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |