C18H20N2O3S — CID 72899575
4-[1-(thiophen-2-ylmethylcarbamoyl)piperidin-3-yl]benzoic acid (PubChem CID 72899575) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-[1-(thiophen-2-ylmethylcarbamoyl)piperidin-3-yl]benzoic acid.
| Compound Name | 4-[1-(thiophen-2-ylmethylcarbamoyl)piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 72899575 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-[1-(thiophen-2-ylmethylcarbamoyl)piperidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2CCCN(C(=O)NCc3cccs3)C2)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c21-17(22)14-7-5-13(6-8-14)15-3-1-9-20(12-15)18(23)19-11-16-4-2-10-24-16/h2,4-8,10,15H,1,3,9,11-12H2,(H,19,23)(H,21,22) |
| InChIKey | NGSCENYEJRXABB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |