C15H16N6OS — CID 72901054
2-(2-phenylimidazol-1-yl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide (PubChem CID 72901054) has the molecular formula C15H16N6OS and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-(2-phenylimidazol-1-yl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(2-phenylimidazol-1-yl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 72901054 |
| Molecular Formula | C15H16N6OS |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-(2-phenylimidazol-1-yl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
| SMILES | O=C(Cn1ccnc1-c1ccccc1)NCCSc1ncn[nH]1 |
| InChI | InChI=1S/C15H16N6OS/c22-13(16-7-9-23-15-18-11-19-20-15)10-21-8-6-17-14(21)12-4-2-1-3-5-12/h1-6,8,11H,7,9-10H2,(H,16,22)(H,18,19,20) |
| InChIKey | MIYYOBZRSAZLCR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|