C16H18N2O3S — CID 72905100
2-(4-pyridin-3-yloxypiperidin-1-yl)-2-thiophen-3-ylacetic acid (PubChem CID 72905100) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-(4-pyridin-3-yloxypiperidin-1-yl)-2-thiophen-3-ylacetic acid.
| Compound Name | 2-(4-pyridin-3-yloxypiperidin-1-yl)-2-thiophen-3-ylacetic acid |
|---|---|
| PubChem CID | 72905100 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-(4-pyridin-3-yloxypiperidin-1-yl)-2-thiophen-3-ylacetic acid |
| SMILES | O=C(O)C(c1ccsc1)N1CCC(Oc2cccnc2)CC1 |
| InChI | InChI=1S/C16H18N2O3S/c19-16(20)15(12-5-9-22-11-12)18-7-3-13(4-8-18)21-14-2-1-6-17-10-14/h1-2,5-6,9-11,13,15H,3-4,7-8H2,(H,19,20) |
| InChIKey | VWXRLFQHRMMJAO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |