C15H23N5O3S — CID 72905326
[(4aS,7aR)-1-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone (PubChem CID 72905326) has the molecular formula C15H23N5O3S and a molecular weight of 353.45 g/mol. Its IUPAC name is [(4aS,7aR)-1-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone.
| Compound Name | [(4aS,7aR)-1-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 72905326 |
| Molecular Formula | C15H23N5O3S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | [(4aS,7aR)-1-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone |
| SMILES | Cc1nc(CN2CCN(C(=O)C3CC3)[C@@H]3CS(=O)(=O)C[C@@H]32)n(C)n1 |
| InChI | InChI=1S/C15H23N5O3S/c1-10-16-14(18(2)17-10)7-19-5-6-20(15(21)11-3-4-11)13-9-24(22,23)8-12(13)19/h11-13H,3-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | CCQJMXKYDHXIAC-QWHCGFSZSA-N |
| XLogP | -0.66 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |