C19H33N5O3 — CID 72907866
(2S,4S)-N-ethyl-1-(2-propoxyethyl)-4-[4-(1H-pyrazol-4-yl)butanoylamino]pyrrolidine-2-carboxamide (PubChem CID 72907866) has the molecular formula C19H33N5O3 and a molecular weight of 379.51 g/mol. Its IUPAC name is (2S,4S)-N-ethyl-1-(2-propoxyethyl)-4-[4-(1H-pyrazol-4-yl)butanoylamino]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-ethyl-1-(2-propoxyethyl)-4-[4-(1H-pyrazol-4-yl)butanoylamino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 72907866 |
| Molecular Formula | C19H33N5O3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | (2S,4S)-N-ethyl-1-(2-propoxyethyl)-4-[4-(1H-pyrazol-4-yl)butanoylamino]pyrrolidine-2-carboxamide |
| SMILES | CCCOCCN1C[C@@H](NC(=O)CCCc2cn[nH]c2)C[C@H]1C(=O)NCC |
| InChI | InChI=1S/C19H33N5O3/c1-3-9-27-10-8-24-14-16(11-17(24)19(26)20-4-2)23-18(25)7-5-6-15-12-21-22-13-15/h12-13,16-17H,3-11,14H2,1-2H3,(H,20,26)(H,21,22)(H,23,25)/t16-,17-/m0/s1 |
| InChIKey | RJZXKPFOFXTHMS-IRXDYDNUSA-N |
| XLogP | 0.85 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|