C17H25N5O4 — CID 72908397
N-[(3S,5S)-1-(3-ethoxypropanoyl)-5-(ethylcarbamoyl)pyrrolidin-3-yl]pyrazine-2-carboxamide (PubChem CID 72908397) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[(3S,5S)-1-(3-ethoxypropanoyl)-5-(ethylcarbamoyl)pyrrolidin-3-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(3S,5S)-1-(3-ethoxypropanoyl)-5-(ethylcarbamoyl)pyrrolidin-3-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 72908397 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-[(3S,5S)-1-(3-ethoxypropanoyl)-5-(ethylcarbamoyl)pyrrolidin-3-yl]pyrazine-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1C[C@H](NC(=O)c2cnccn2)CN1C(=O)CCOCC |
| InChI | InChI=1S/C17H25N5O4/c1-3-19-17(25)14-9-12(11-22(14)15(23)5-8-26-4-2)21-16(24)13-10-18-6-7-20-13/h6-7,10,12,14H,3-5,8-9,11H2,1-2H3,(H,19,25)(H,21,24)/t12-,14-/m0/s1 |
| InChIKey | KGPMBOSITRTEAZ-JSGCOSHPSA-N |
| XLogP | -0.26 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|