C16H17ClF2N2O3 — CID 72907958
(3aS,7aR)-2-(2-chloro-4,5-difluorobenzoyl)-5-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid (PubChem CID 72907958) has the molecular formula C16H17ClF2N2O3 and a molecular weight of 358.77 g/mol. Its IUPAC name is (3aS,7aR)-2-(2-chloro-4,5-difluorobenzoyl)-5-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid.
| Compound Name | (3aS,7aR)-2-(2-chloro-4,5-difluorobenzoyl)-5-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid |
|---|---|
| PubChem CID | 72907958 |
| Molecular Formula | C16H17ClF2N2O3 |
| Molecular Weight | 358.77 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | (3aS,7aR)-2-(2-chloro-4,5-difluorobenzoyl)-5-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid |
| SMILES | CN1CC[C@H]2CN(C(=O)c3cc(F)c(F)cc3Cl)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C16H17ClF2N2O3/c1-20-3-2-9-6-21(8-16(9,7-20)15(23)24)14(22)10-4-12(18)13(19)5-11(10)17/h4-5,9H,2-3,6-8H2,1H3,(H,23,24)/t9-,16-/m0/s1 |
| InChIKey | FJCWIFANSXWCCO-FVMDXXJSSA-N |
| XLogP | 2.10 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.77 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|