C17H19N5O2 — CID 72909849
2-[[2-(3-methoxyphenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-5-methyl-1,3,4-oxadiazole (PubChem CID 72909849) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-[[2-(3-methoxyphenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[[2-(3-methoxyphenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 72909849 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[[2-(3-methoxyphenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-5-methyl-1,3,4-oxadiazole |
| SMILES | COc1cccc(-c2nc3c([nH]2)CN(Cc2nnc(C)o2)CC3)c1 |
| InChI | InChI=1S/C17H19N5O2/c1-11-20-21-16(24-11)10-22-7-6-14-15(9-22)19-17(18-14)12-4-3-5-13(8-12)23-2/h3-5,8H,6-7,9-10H2,1-2H3,(H,18,19) |
| InChIKey | GSTSJEMHJQGGBZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |