C18H33N3O2 — CID 72911123
2-[(3R,4S)-3-acetamido-4-propylpyrrolidin-1-yl]-N-cycloheptylacetamide (PubChem CID 72911123) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 2-[(3R,4S)-3-acetamido-4-propylpyrrolidin-1-yl]-N-cycloheptylacetamide.
| Compound Name | 2-[(3R,4S)-3-acetamido-4-propylpyrrolidin-1-yl]-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 72911123 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 2-[(3R,4S)-3-acetamido-4-propylpyrrolidin-1-yl]-N-cycloheptylacetamide |
| SMILES | CCC[C@H]1CN(CC(=O)NC2CCCCCC2)C[C@@H]1NC(C)=O |
| InChI | InChI=1S/C18H33N3O2/c1-3-8-15-11-21(12-17(15)19-14(2)22)13-18(23)20-16-9-6-4-5-7-10-16/h15-17H,3-13H2,1-2H3,(H,19,22)(H,20,23)/t15-,17-/m0/s1 |
| InChIKey | RAHGTZRUYXSKND-RDJZCZTQSA-N |
| XLogP | 2.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |