About N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide
N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide (PubChem CID 72888251) has the molecular formula C17H33N3O3S
and a molecular weight of 359.54 g/mol. Its IUPAC name is N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide.
Molecular Properties
| Compound Name | N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide |
| PubChem CID | 72888251 |
| Molecular Formula | C17H33N3O3S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide |
| SMILES | CC(C)[C@H]1CN(CC(=O)NC2CCCCCC2)C[C@@H]1NS(C)(=O)=O |
| InChI | InChI=1S/C17H33N3O3S/c1-13(2)15-10-20(11-16(15)19-24(3,22)23)12-17(21)18-14-8-6-4-5-7-9-14/h13-16,19H,4-12H2,1-3H3,(H,18,21)/t15-,16+/m1/s1 |
| InChIKey | XDPHBTRAAQKHKB-CVEARBPZSA-N |
| XLogP | 1.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide?
The IUPAC name of N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide (CID 72888251) is N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide.
What is the SMILES notation for N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide?
The canonical SMILES for N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide is CC(C)[C@H]1CN(CC(=O)NC2CCCCCC2)C[C@@H]1NS(C)(=O)=O.
What is the InChIKey of N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide?
The InChIKey is XDPHBTRAAQKHKB-CVEARBPZSA-N. The full InChI is InChI=1S/C17H33N3O3S/c1-13(2)15-10-20(11-16(15)19-24(3,22)23)12-17(21)18-14-8-6-4-5-7-9-14/h13-16,19H,4-12H2,1-3H3,(H,18,21)/t15-,16+/m1/s1.
What are the key properties of N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide?
N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide has a molecular weight of 359.54 g/mol, XLogP of 1.33, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-2-[(3R,4S)-3-(methanesulfonamido)-4-propan-2-ylpyrrolidin-1-yl]acetamide is sourced from PubChem (CID 72888251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).