C20H30N2O2 — CID 72911900
1-[(1S,5R)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-2-butoxyethanone (PubChem CID 72911900) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[(1S,5R)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-2-butoxyethanone.
| Compound Name | 1-[(1S,5R)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-2-butoxyethanone |
|---|---|
| PubChem CID | 72911900 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-[(1S,5R)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-2-butoxyethanone |
| SMILES | CCCCOCC(=O)N1C[C@H]2CC[C@@H]1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C20H30N2O2/c1-2-3-11-24-16-20(23)22-14-18-9-10-19(22)15-21(13-18)12-17-7-5-4-6-8-17/h4-8,18-19H,2-3,9-16H2,1H3/t18-,19+/m0/s1 |
| InChIKey | LOQHMIBZIPCXIN-RBUKOAKNSA-N |
| XLogP | 2.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|