C17H24N4O2 — CID 155563163
[2-[(1R,5S)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-2-oxoethyl]urea (PubChem CID 155563163) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is [2-[(1R,5S)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-2-oxoethyl]urea.
| Compound Name | [2-[(1R,5S)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 155563163 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [2-[(1R,5S)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-2-oxoethyl]urea |
| SMILES | NC(=O)NCC(=O)N1C[C@@H]2CC[C@H]1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C17H24N4O2/c18-17(23)19-8-16(22)21-11-14-6-7-15(21)12-20(10-14)9-13-4-2-1-3-5-13/h1-5,14-15H,6-12H2,(H3,18,19,23)/t14-,15+/m1/s1 |
| InChIKey | KGHMUKIPFWRZGA-CABCVRRESA-N |
| XLogP | 0.78 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |