C16H20N4O4S — CID 72913778
1-[3-(1,3-oxazol-5-yl)phenyl]-3-(2-pyrrolidin-1-ylsulfonylethyl)urea (PubChem CID 72913778) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is 1-[3-(1,3-oxazol-5-yl)phenyl]-3-(2-pyrrolidin-1-ylsulfonylethyl)urea.
| Compound Name | 1-[3-(1,3-oxazol-5-yl)phenyl]-3-(2-pyrrolidin-1-ylsulfonylethyl)urea |
|---|---|
| PubChem CID | 72913778 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-[3-(1,3-oxazol-5-yl)phenyl]-3-(2-pyrrolidin-1-ylsulfonylethyl)urea |
| SMILES | O=C(NCCS(=O)(=O)N1CCCC1)Nc1cccc(-c2cnco2)c1 |
| InChI | InChI=1S/C16H20N4O4S/c21-16(18-6-9-25(22,23)20-7-1-2-8-20)19-14-5-3-4-13(10-14)15-11-17-12-24-15/h3-5,10-12H,1-2,6-9H2,(H2,18,19,21) |
| InChIKey | JKWCHAGGFOWOIJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |