C22H28NO4- — CID 7291560
(3R)-3-(adamantane-1-carbonylamino)-3-(4-ethoxyphenyl)propanoate (PubChem CID 7291560) has the molecular formula C22H28NO4- and a molecular weight of 370.47 g/mol. Its IUPAC name is (3R)-3-(adamantane-1-carbonylamino)-3-(4-ethoxyphenyl)propanoate.
| Compound Name | (3R)-3-(adamantane-1-carbonylamino)-3-(4-ethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7291560 |
| Molecular Formula | C22H28NO4- |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (3R)-3-(adamantane-1-carbonylamino)-3-(4-ethoxyphenyl)propanoate |
| SMILES | CCOc1ccc([C@@H](CC(=O)[O-])NC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H29NO4/c1-2-27-18-5-3-17(4-6-18)19(10-20(24)25)23-21(26)22-11-14-7-15(12-22)9-16(8-14)13-22/h3-6,14-16,19H,2,7-13H2,1H3,(H,23,26)(H,24,25)/p-1/t14?,15?,16?,19-,22?/m1/s1 |
| InChIKey | DCHDTVPLHXJQSQ-FRXJQHJJSA-M |
| XLogP | 2.60 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |