C13H16NO4- — CID 6921315
(3R)-3-acetamido-3-(4-ethoxyphenyl)propanoate (PubChem CID 6921315) has the molecular formula C13H16NO4- and a molecular weight of 250.27 g/mol. Its IUPAC name is (3R)-3-acetamido-3-(4-ethoxyphenyl)propanoate.
| Compound Name | (3R)-3-acetamido-3-(4-ethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 6921315 |
| Molecular Formula | C13H16NO4- |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (3R)-3-acetamido-3-(4-ethoxyphenyl)propanoate |
| SMILES | CCOc1ccc([C@@H](CC(=O)[O-])NC(C)=O)cc1 |
| InChI | InChI=1S/C13H17NO4/c1-3-18-11-6-4-10(5-7-11)12(8-13(16)17)14-9(2)15/h4-7,12H,3,8H2,1-2H3,(H,14,15)(H,16,17)/p-1/t12-/m1/s1 |
| InChIKey | OODFNSFRXFOACA-GFCCVEGCSA-M |
| XLogP | 0.40 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |