C13H15N5O — CID 72917705
1-[3-(tetrazol-1-yl)propyl]-3,4-dihydroquinolin-2-one (PubChem CID 72917705) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-[3-(tetrazol-1-yl)propyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[3-(tetrazol-1-yl)propyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 72917705 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-[3-(tetrazol-1-yl)propyl]-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2ccccc2N1CCCn1cnnn1 |
| InChI | InChI=1S/C13H15N5O/c19-13-7-6-11-4-1-2-5-12(11)18(13)9-3-8-17-10-14-15-16-17/h1-2,4-5,10H,3,6-9H2 |
| InChIKey | KSCNOVMGBXUPMF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |