C17H15N5O — CID 16648332
3,4-dihydro-2H-quinolin-1-yl-[3-(tetrazol-1-yl)phenyl]methanone (PubChem CID 16648332) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-[3-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-[3-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 16648332 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-[3-(tetrazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-n2cnnn2)c1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C17H15N5O/c23-17(21-10-4-7-13-5-1-2-9-16(13)21)14-6-3-8-15(11-14)22-12-18-19-20-22/h1-3,5-6,8-9,11-12H,4,7,10H2 |
| InChIKey | YPCKUFXECXYLIU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |