C11H18N4O3S — CID 72918635
2-ethyl-N-[2-[methyl(methylsulfonyl)amino]ethyl]pyrimidine-5-carboxamide (PubChem CID 72918635) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-ethyl-N-[2-[methyl(methylsulfonyl)amino]ethyl]pyrimidine-5-carboxamide.
| Compound Name | 2-ethyl-N-[2-[methyl(methylsulfonyl)amino]ethyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72918635 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-ethyl-N-[2-[methyl(methylsulfonyl)amino]ethyl]pyrimidine-5-carboxamide |
| SMILES | CCc1ncc(C(=O)NCCN(C)S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C11H18N4O3S/c1-4-10-13-7-9(8-14-10)11(16)12-5-6-15(2)19(3,17)18/h7-8H,4-6H2,1-3H3,(H,12,16) |
| InChIKey | WHEPHZYFQJAIRX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |