C13H22N6O3S — CID 72919197
1-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 72919197) has the molecular formula C13H22N6O3S and a molecular weight of 342.43 g/mol. Its IUPAC name is 1-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 72919197 |
| Molecular Formula | C13H22N6O3S |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | CC(C)CN1CCN(C(=O)Cn2cnnn2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C13H22N6O3S/c1-10(2)5-17-3-4-19(12-8-23(21,22)7-11(12)17)13(20)6-18-9-14-15-16-18/h9-12H,3-8H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | FFASXMDVDMCZRW-NEPJUHHUSA-N |
| XLogP | -1.36 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |