C16H24N4OS — CID 72923391
[(1R,5R)-6-(3-methylsulfanylpropyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-pyrazin-2-ylmethanone (PubChem CID 72923391) has the molecular formula C16H24N4OS and a molecular weight of 320.46 g/mol. Its IUPAC name is [(1R,5R)-6-(3-methylsulfanylpropyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(1R,5R)-6-(3-methylsulfanylpropyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 72923391 |
| Molecular Formula | C16H24N4OS |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | [(1R,5R)-6-(3-methylsulfanylpropyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-pyrazin-2-ylmethanone |
| SMILES | CSCCCN1C[C@H]2CC[C@@H]1CN(C(=O)c1cnccn1)C2 |
| InChI | InChI=1S/C16H24N4OS/c1-22-8-2-7-19-10-13-3-4-14(19)12-20(11-13)16(21)15-9-17-5-6-18-15/h5-6,9,13-14H,2-4,7-8,10-12H2,1H3/t13-,14-/m1/s1 |
| InChIKey | KBNUTSNKCVUIJK-ZIAGYGMSSA-N |
| XLogP | 1.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|