C17H17FN2O3S — CID 72923615
2-[4-[(4-fluorophenyl)methyl]-3-oxopiperazin-1-yl]-2-thiophen-3-ylacetic acid (PubChem CID 72923615) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methyl]-3-oxopiperazin-1-yl]-2-thiophen-3-ylacetic acid.
| Compound Name | 2-[4-[(4-fluorophenyl)methyl]-3-oxopiperazin-1-yl]-2-thiophen-3-ylacetic acid |
|---|---|
| PubChem CID | 72923615 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methyl]-3-oxopiperazin-1-yl]-2-thiophen-3-ylacetic acid |
| SMILES | O=C(O)C(c1ccsc1)N1CCN(Cc2ccc(F)cc2)C(=O)C1 |
| InChI | InChI=1S/C17H17FN2O3S/c18-14-3-1-12(2-4-14)9-19-6-7-20(10-15(19)21)16(17(22)23)13-5-8-24-11-13/h1-5,8,11,16H,6-7,9-10H2,(H,22,23) |
| InChIKey | LCFJMCQZJVYIHT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |