C17H17N3 — CID 729258
3-[(1S)-cyclohex-3-en-1-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 729258) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-[(1S)-cyclohex-3-en-1-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[(1S)-cyclohex-3-en-1-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 729258 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-[(1S)-cyclohex-3-en-1-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cn1c(C(C#N)=C[C@@H]2CC=CCC2)nc2ccccc21 |
| InChI | InChI=1S/C17H17N3/c1-20-16-10-6-5-9-15(16)19-17(20)14(12-18)11-13-7-3-2-4-8-13/h2-3,5-6,9-11,13H,4,7-8H2,1H3/t13-/m1/s1 |
| InChIKey | OJYZGNBYYSIUDR-CYBMUJFWSA-N |
| XLogP | 3.84 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|