C14H22N4O — CID 72925819
(3R,4R)-1-(4-aminopyrimidin-2-yl)-4-cyclobutyl-3-methylpiperidin-4-ol (PubChem CID 72925819) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is (3R,4R)-1-(4-aminopyrimidin-2-yl)-4-cyclobutyl-3-methylpiperidin-4-ol.
| Compound Name | (3R,4R)-1-(4-aminopyrimidin-2-yl)-4-cyclobutyl-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 72925819 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (3R,4R)-1-(4-aminopyrimidin-2-yl)-4-cyclobutyl-3-methylpiperidin-4-ol |
| SMILES | C[C@@H]1CN(c2nccc(N)n2)CC[C@@]1(O)C1CCC1 |
| InChI | InChI=1S/C14H22N4O/c1-10-9-18(13-16-7-5-12(15)17-13)8-6-14(10,19)11-3-2-4-11/h5,7,10-11,19H,2-4,6,8-9H2,1H3,(H2,15,16,17)/t10-,14+/m1/s1 |
| InChIKey | XKFDDXBJOABGCB-YGRLFVJLSA-N |
| XLogP | 1.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |