C16H19F4NO4 — CID 72931030
N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 72931030) has the molecular formula C16H19F4NO4 and a molecular weight of 365.32 g/mol. Its IUPAC name is N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 72931030 |
| Molecular Formula | C16H19F4NO4 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | COc1cccc2c1OCC(CNC(=O)COCC(F)(F)C(F)F)C2 |
| InChI | InChI=1S/C16H19F4NO4/c1-23-12-4-2-3-11-5-10(7-25-14(11)12)6-21-13(22)8-24-9-16(19,20)15(17)18/h2-4,10,15H,5-9H2,1H3,(H,21,22) |
| InChIKey | IDANNWOIBGJPGJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|