C17H15FN2O3S — CID 72932073
5-[[[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]methyl]thiophene-2-carboxylic acid (PubChem CID 72932073) has the molecular formula C17H15FN2O3S and a molecular weight of 346.38 g/mol. Its IUPAC name is 5-[[[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 72932073 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 5-[[[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]methyl]thiophene-2-carboxylic acid |
| SMILES | Cc1[nH]c2c(F)cccc2c1CC(=O)NCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C17H15FN2O3S/c1-9-12(11-3-2-4-13(18)16(11)20-9)7-15(21)19-8-10-5-6-14(24-10)17(22)23/h2-6,20H,7-8H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | ZTCUQAKKFCGXCR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|