C17H17FN4O — CID 72932525
6-fluoro-2-[[methyl(1-pyrimidin-4-ylethyl)amino]methyl]-1H-quinolin-4-one (PubChem CID 72932525) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is 6-fluoro-2-[[methyl(1-pyrimidin-4-ylethyl)amino]methyl]-1H-quinolin-4-one.
| Compound Name | 6-fluoro-2-[[methyl(1-pyrimidin-4-ylethyl)amino]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 72932525 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 6-fluoro-2-[[methyl(1-pyrimidin-4-ylethyl)amino]methyl]-1H-quinolin-4-one |
| SMILES | CC(c1ccncn1)N(C)Cc1cc(=O)c2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C17H17FN4O/c1-11(15-5-6-19-10-20-15)22(2)9-13-8-17(23)14-7-12(18)3-4-16(14)21-13/h3-8,10-11H,9H2,1-2H3,(H,21,23) |
| InChIKey | ZGCDNQIYQUXMDI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |