C22H22N2O4 — CID 7293257
N-(2-ethoxyphenyl)-2-(1-oxo-2-prop-2-enylisoquinolin-5-yl)oxyacetamide (PubChem CID 7293257) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-(1-oxo-2-prop-2-enylisoquinolin-5-yl)oxyacetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-(1-oxo-2-prop-2-enylisoquinolin-5-yl)oxyacetamide |
|---|---|
| PubChem CID | 7293257 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-(1-oxo-2-prop-2-enylisoquinolin-5-yl)oxyacetamide |
| SMILES | C=CCn1ccc2c(OCC(=O)Nc3ccccc3OCC)cccc2c1=O |
| InChI | InChI=1S/C22H22N2O4/c1-3-13-24-14-12-16-17(22(24)26)8-7-11-19(16)28-15-21(25)23-18-9-5-6-10-20(18)27-4-2/h3,5-12,14H,1,4,13,15H2,2H3,(H,23,25) |
| InChIKey | KNUXETBKLQITRA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|