C19H22N2O3 — CID 7293273
N-cyclopentyl-2-(1-oxo-2-prop-2-enylisoquinolin-5-yl)oxyacetamide (PubChem CID 7293273) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-cyclopentyl-2-(1-oxo-2-prop-2-enylisoquinolin-5-yl)oxyacetamide.
| Compound Name | N-cyclopentyl-2-(1-oxo-2-prop-2-enylisoquinolin-5-yl)oxyacetamide |
|---|---|
| PubChem CID | 7293273 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-cyclopentyl-2-(1-oxo-2-prop-2-enylisoquinolin-5-yl)oxyacetamide |
| SMILES | C=CCn1ccc2c(OCC(=O)NC3CCCC3)cccc2c1=O |
| InChI | InChI=1S/C19H22N2O3/c1-2-11-21-12-10-15-16(19(21)23)8-5-9-17(15)24-13-18(22)20-14-6-3-4-7-14/h2,5,8-10,12,14H,1,3-4,6-7,11,13H2,(H,20,22) |
| InChIKey | MFUFSSSCAVDWIC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|