C18H19N5O2 — CID 72933391
(7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-(7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methanone (PubChem CID 72933391) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is (7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-(7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methanone.
| Compound Name | (7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-(7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methanone |
|---|---|
| PubChem CID | 72933391 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-(7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methanone |
| SMILES | COc1ccc2c(c1)CCN(C(=O)c1nnc3nc(C)ccn13)CC2 |
| InChI | InChI=1S/C18H19N5O2/c1-12-5-10-23-16(20-21-18(23)19-12)17(24)22-8-6-13-3-4-15(25-2)11-14(13)7-9-22/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | FPHCMNLOHBLWIA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |