C20H27F2N3O — CID 72933929
1-[(2R,3R,6R)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-[ethyl(methyl)amino]ethanone (PubChem CID 72933929) has the molecular formula C20H27F2N3O and a molecular weight of 363.45 g/mol. Its IUPAC name is 1-[(2R,3R,6R)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-[ethyl(methyl)amino]ethanone.
| Compound Name | 1-[(2R,3R,6R)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-[ethyl(methyl)amino]ethanone |
|---|---|
| PubChem CID | 72933929 |
| Molecular Formula | C20H27F2N3O |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-[(2R,3R,6R)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-[ethyl(methyl)amino]ethanone |
| SMILES | CCN(C)CC(=O)N1C[C@@H](c2cccc(F)c2F)[C@@H]2[C@H]1C1CCN2CC1 |
| InChI | InChI=1S/C20H27F2N3O/c1-3-23(2)12-17(26)25-11-15(14-5-4-6-16(21)18(14)22)20-19(25)13-7-9-24(20)10-8-13/h4-6,13,15,19-20H,3,7-12H2,1-2H3/t15-,19+,20+/m0/s1 |
| InChIKey | WQOHDHHUEKTBDU-CWFSZBLJSA-N |
| XLogP | 2.31 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |