C21H27F2N3O — CID 133130471
(2S,3S,6S)-N-cyclopentyl-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carboxamide (PubChem CID 133130471) has the molecular formula C21H27F2N3O and a molecular weight of 375.46 g/mol. Its IUPAC name is (2S,3S,6S)-N-cyclopentyl-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carboxamide.
| Compound Name | (2S,3S,6S)-N-cyclopentyl-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carboxamide |
|---|---|
| PubChem CID | 133130471 |
| Molecular Formula | C21H27F2N3O |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (2S,3S,6S)-N-cyclopentyl-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carboxamide |
| SMILES | O=C(NC1CCCC1)N1C[C@H](c2cccc(F)c2F)[C@H]2[C@@H]1C1CCN2CC1 |
| InChI | InChI=1S/C21H27F2N3O/c22-17-7-3-6-15(18(17)23)16-12-26(21(27)24-14-4-1-2-5-14)19-13-8-10-25(11-9-13)20(16)19/h3,6-7,13-14,16,19-20H,1-2,4-5,8-12H2,(H,24,27)/t16-,19+,20+/m1/s1 |
| InChIKey | FFZRVMLFVKVCEW-UXPWSPDFSA-N |
| XLogP | 3.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |