C21H22F2N4O — CID 56878999
[(2R,3R,6R)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(5-methylpyrazin-2-yl)methanone (PubChem CID 56878999) has the molecular formula C21H22F2N4O and a molecular weight of 384.43 g/mol. Its IUPAC name is [(2R,3R,6R)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(5-methylpyrazin-2-yl)methanone.
| Compound Name | [(2R,3R,6R)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 56878999 |
| Molecular Formula | C21H22F2N4O |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | [(2R,3R,6R)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(5-methylpyrazin-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)N2C[C@@H](c3cccc(F)c3F)[C@@H]3[C@H]2C2CCN3CC2)cn1 |
| InChI | InChI=1S/C21H22F2N4O/c1-12-9-25-17(10-24-12)21(28)27-11-15(14-3-2-4-16(22)18(14)23)20-19(27)13-5-7-26(20)8-6-13/h2-4,9-10,13,15,19-20H,5-8,11H2,1H3/t15-,19+,20+/m0/s1 |
| InChIKey | GXAZYEMZZZSTKJ-CWFSZBLJSA-N |
| XLogP | 2.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |