C22H20F4N2O — CID 133130810
(2,4-difluorophenyl)-[(2S,3S,6S)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone (PubChem CID 133130810) has the molecular formula C22H20F4N2O and a molecular weight of 404.41 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[(2S,3S,6S)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone.
| Compound Name | (2,4-difluorophenyl)-[(2S,3S,6S)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
|---|---|
| PubChem CID | 133130810 |
| Molecular Formula | C22H20F4N2O |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (2,4-difluorophenyl)-[(2S,3S,6S)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1F)N1C[C@H](c2cccc(F)c2F)[C@H]2[C@@H]1C1CCN2CC1 |
| InChI | InChI=1S/C22H20F4N2O/c23-13-4-5-15(18(25)10-13)22(29)28-11-16(14-2-1-3-17(24)19(14)26)21-20(28)12-6-8-27(21)9-7-12/h1-5,10,12,16,20-21H,6-9,11H2/t16-,20+,21+/m1/s1 |
| InChIKey | LUZVIQBUAMNRFG-CZAAIQMYSA-N |
| XLogP | 3.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |