C20H20F2N2O2 — CID 133129490
[(2S,3S,6S)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(furan-3-yl)methanone (PubChem CID 133129490) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is [(2S,3S,6S)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(furan-3-yl)methanone.
| Compound Name | [(2S,3S,6S)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 133129490 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [(2S,3S,6S)-3-(2,3-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1C[C@H](c2cccc(F)c2F)[C@H]2[C@@H]1C1CCN2CC1 |
| InChI | InChI=1S/C20H20F2N2O2/c21-16-3-1-2-14(17(16)22)15-10-24(20(25)13-6-9-26-11-13)18-12-4-7-23(8-5-12)19(15)18/h1-3,6,9,11-12,15,18-19H,4-5,7-8,10H2/t15-,18+,19+/m1/s1 |
| InChIKey | LVRZWZJQJWBBOZ-MNEFBYGVSA-N |
| XLogP | 3.26 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |