C21H35N3O3 — CID 72935171
(4aS,8aS)-7-[[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol (PubChem CID 72935171) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is (4aS,8aS)-7-[[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol.
| Compound Name | (4aS,8aS)-7-[[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol |
|---|---|
| PubChem CID | 72935171 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | (4aS,8aS)-7-[[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol |
| SMILES | CCOc1cc(CN2CC[C@@]3(O)CCNC[C@H]3C2)ccc1OCCN(C)C |
| InChI | InChI=1S/C21H35N3O3/c1-4-26-20-13-17(5-6-19(20)27-12-11-23(2)3)15-24-10-8-21(25)7-9-22-14-18(21)16-24/h5-6,13,18,22,25H,4,7-12,14-16H2,1-3H3/t18-,21-/m0/s1 |
| InChIKey | ZLIMKWIPXSESFX-RXVVDRJESA-N |
| XLogP | 1.57 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |