C23H30N2O2 — CID 72878234
(4aS,8aS)-7-[[2-[(2-methylphenyl)methoxy]phenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol (PubChem CID 72878234) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (4aS,8aS)-7-[[2-[(2-methylphenyl)methoxy]phenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol.
| Compound Name | (4aS,8aS)-7-[[2-[(2-methylphenyl)methoxy]phenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol |
|---|---|
| PubChem CID | 72878234 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (4aS,8aS)-7-[[2-[(2-methylphenyl)methoxy]phenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol |
| SMILES | Cc1ccccc1COc1ccccc1CN1CC[C@@]2(O)CCNC[C@H]2C1 |
| InChI | InChI=1S/C23H30N2O2/c1-18-6-2-3-8-20(18)17-27-22-9-5-4-7-19(22)15-25-13-11-23(26)10-12-24-14-21(23)16-25/h2-9,21,24,26H,10-17H2,1H3/t21-,23-/m0/s1 |
| InChIKey | QIMJPZHMSWRZHV-GMAHTHKFSA-N |
| XLogP | 3.12 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |