C16H20F4N2O — CID 133120249
(4aR,8aR)-7-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol (PubChem CID 133120249) has the molecular formula C16H20F4N2O and a molecular weight of 332.34 g/mol. Its IUPAC name is (4aR,8aR)-7-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol.
| Compound Name | (4aR,8aR)-7-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol |
|---|---|
| PubChem CID | 133120249 |
| Molecular Formula | C16H20F4N2O |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (4aR,8aR)-7-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol |
| SMILES | O[C@@]12CCNC[C@@H]1CN(Cc1cc(F)cc(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C16H20F4N2O/c17-14-6-11(5-12(7-14)16(18,19)20)9-22-4-2-15(23)1-3-21-8-13(15)10-22/h5-7,13,21,23H,1-4,8-10H2/t13-,15-/m1/s1 |
| InChIKey | JBBHQVRDDNHYRF-UKRRQHHQSA-N |
| XLogP | 2.39 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |