C21H27N3O3 — CID 72935785
N-[(3-methoxyphenyl)methyl]-3-[1-(1H-pyrrole-3-carbonyl)piperidin-3-yl]propanamide (PubChem CID 72935785) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-3-[1-(1H-pyrrole-3-carbonyl)piperidin-3-yl]propanamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-3-[1-(1H-pyrrole-3-carbonyl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 72935785 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-3-[1-(1H-pyrrole-3-carbonyl)piperidin-3-yl]propanamide |
| SMILES | COc1cccc(CNC(=O)CCC2CCCN(C(=O)c3cc[nH]c3)C2)c1 |
| InChI | InChI=1S/C21H27N3O3/c1-27-19-6-2-4-17(12-19)13-23-20(25)8-7-16-5-3-11-24(15-16)21(26)18-9-10-22-14-18/h2,4,6,9-10,12,14,16,22H,3,5,7-8,11,13,15H2,1H3,(H,23,25) |
| InChIKey | CXTUPGXHWQBSEZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |