C20H26N4O2 — CID 72937360
(3aR,6aR)-5-(5-cyano-4,6-dimethyl-2-pyridinyl)-2-(cyclobutylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72937360) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (3aR,6aR)-5-(5-cyano-4,6-dimethyl-2-pyridinyl)-2-(cyclobutylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-(5-cyano-4,6-dimethyl-2-pyridinyl)-2-(cyclobutylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72937360 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (3aR,6aR)-5-(5-cyano-4,6-dimethyl-2-pyridinyl)-2-(cyclobutylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1cc(N2C[C@H]3CN(CC4CCC4)C[C@@]3(C(=O)O)C2)nc(C)c1C#N |
| InChI | InChI=1S/C20H26N4O2/c1-13-6-18(22-14(2)17(13)7-21)24-10-16-9-23(8-15-4-3-5-15)11-20(16,12-24)19(25)26/h6,15-16H,3-5,8-12H2,1-2H3,(H,25,26)/t16-,20-/m1/s1 |
| InChIKey | HUHLRRXEZGOWJV-OXQOHEQNSA-N |
| XLogP | 2.19 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |