C18H21N3O2S2 — CID 72939461
2-[5-(methylcarbamoyl)thiophen-2-yl]-N-(3-methylsulfanylphenyl)pyrrolidine-1-carboxamide (PubChem CID 72939461) has the molecular formula C18H21N3O2S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-[5-(methylcarbamoyl)thiophen-2-yl]-N-(3-methylsulfanylphenyl)pyrrolidine-1-carboxamide.
| Compound Name | 2-[5-(methylcarbamoyl)thiophen-2-yl]-N-(3-methylsulfanylphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 72939461 |
| Molecular Formula | C18H21N3O2S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-[5-(methylcarbamoyl)thiophen-2-yl]-N-(3-methylsulfanylphenyl)pyrrolidine-1-carboxamide |
| SMILES | CNC(=O)c1ccc(C2CCCN2C(=O)Nc2cccc(SC)c2)s1 |
| InChI | InChI=1S/C18H21N3O2S2/c1-19-17(22)16-9-8-15(25-16)14-7-4-10-21(14)18(23)20-12-5-3-6-13(11-12)24-2/h3,5-6,8-9,11,14H,4,7,10H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | MRXCPAMXMSYDRC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |