C22H20BrFN2O2 — CID 72944202
N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3-fluorobenzamide (PubChem CID 72944202) has the molecular formula C22H20BrFN2O2 and a molecular weight of 443.32 g/mol. Its IUPAC name is N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3-fluorobenzamide.
| Compound Name | N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 72944202 |
| Molecular Formula | C22H20BrFN2O2 |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3-fluorobenzamide |
| SMILES | O=C(NC1CCC(Oc2ccnc3c(Br)cccc23)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H20BrFN2O2/c23-19-6-2-5-18-20(11-12-25-21(18)19)28-17-9-7-16(8-10-17)26-22(27)14-3-1-4-15(24)13-14/h1-6,11-13,16-17H,7-10H2,(H,26,27) |
| InChIKey | ZMKIYBGNNRFQBA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |