C22H19BrF2N2O2 — CID 72944203
N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3,4-difluorobenzamide (PubChem CID 72944203) has the molecular formula C22H19BrF2N2O2 and a molecular weight of 461.31 g/mol. Its IUPAC name is N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3,4-difluorobenzamide.
| Compound Name | N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 72944203 |
| Molecular Formula | C22H19BrF2N2O2 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3,4-difluorobenzamide |
| SMILES | O=C(NC1CCC(Oc2ccnc3c(Br)cccc23)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H19BrF2N2O2/c23-17-3-1-2-16-20(10-11-26-21(16)17)29-15-7-5-14(6-8-15)27-22(28)13-4-9-18(24)19(25)12-13/h1-4,9-12,14-15H,5-8H2,(H,27,28) |
| InChIKey | CHAQOPDYXYGNAM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |