C21H24O4 — CID 72945273
4,17-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaen-10-one (PubChem CID 72945273) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4,17-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaen-10-one.
| Compound Name | 4,17-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaen-10-one |
|---|---|
| PubChem CID | 72945273 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4,17-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaen-10-one |
| SMILES | COc1cc2ccc1Oc1cc(ccc1OC)CCC(=O)CCCC2 |
| InChI | InChI=1S/C21H24O4/c1-23-18-11-8-16-7-10-17(22)6-4-3-5-15-9-12-19(20(13-15)24-2)25-21(18)14-16/h8-9,11-14H,3-7,10H2,1-2H3 |
| InChIKey | VJIRQUUKRUTKNH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |