C21H22O5 — CID 10948208
4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaene-10,12-dione (PubChem CID 10948208) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaene-10,12-dione.
| Compound Name | 4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaene-10,12-dione |
|---|---|
| PubChem CID | 10948208 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaene-10,12-dione |
| SMILES | COc1cc2cc(c1OC)Oc1ccc(cc1)CCC(=O)CC(=O)CC2 |
| InChI | InChI=1S/C21H22O5/c1-24-19-11-15-4-8-17(23)13-16(22)7-3-14-5-9-18(10-6-14)26-20(12-15)21(19)25-2/h5-6,9-12H,3-4,7-8,13H2,1-2H3 |
| InChIKey | NZXBONGDYNBKGC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|