C21H23NO4 — CID 10915200
(11Z)-12-amino-4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one (PubChem CID 10915200) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (11Z)-12-amino-4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one.
| Compound Name | (11Z)-12-amino-4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one |
|---|---|
| PubChem CID | 10915200 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (11Z)-12-amino-4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one |
| SMILES | COc1cc2cc(c1OC)Oc1ccc(cc1)CC/C(N)=C/C(=O)CC2 |
| InChI | InChI=1S/C21H23NO4/c1-24-19-11-15-4-8-17(23)13-16(22)7-3-14-5-9-18(10-6-14)26-20(12-15)21(19)25-2/h5-6,9-13H,3-4,7-8,22H2,1-2H3/b16-13- |
| InChIKey | KQYQMFALVQSWDQ-SSZFMOIBSA-N |
| XLogP | 3.79 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |